C13H25N3 — CID 139538976
N'-[(2E,4Z)-6-iminohepta-2,4-dien-3-yl]-N-methyl-N'-propylethane-1,2-diamine (PubChem CID 139538976) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is N'-[(2E,4Z)-6-iminohepta-2,4-dien-3-yl]-N-methyl-N'-propylethane-1,2-diamine.
| Compound Name | N'-[(2E,4Z)-6-iminohepta-2,4-dien-3-yl]-N-methyl-N'-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 139538976 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | N'-[(2E,4Z)-6-iminohepta-2,4-dien-3-yl]-N-methyl-N'-propylethane-1,2-diamine |
| SMILES | [H]/N=C(C)/C=C\C(=C/C)N(CCC)CCNC |
| InChI | InChI=1S/C13H25N3/c1-5-10-16(11-9-15-4)13(6-2)8-7-12(3)14/h6-8,14-15H,5,9-11H2,1-4H3/b8-7-,13-6+,14-12+ |
| InChIKey | CSHNUUWSGKKIDF-FLFHBANYSA-N |
| XLogP | 2.42 |
| TPSA | 39.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|