C10H18N2 — CID 123635406
N-methyl-2-[[(3Z)-5-methylhexa-3,5-dien-2-ylidene]amino]ethanamine (PubChem CID 123635406) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is N-methyl-2-[[(3Z)-5-methylhexa-3,5-dien-2-ylidene]amino]ethanamine.
| Compound Name | N-methyl-2-[[(3Z)-5-methylhexa-3,5-dien-2-ylidene]amino]ethanamine |
|---|---|
| PubChem CID | 123635406 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | N-methyl-2-[[(3Z)-5-methylhexa-3,5-dien-2-ylidene]amino]ethanamine |
| SMILES | C=C(C)/C=C\C(C)=N\CCNC |
| InChI | InChI=1S/C10H18N2/c1-9(2)5-6-10(3)12-8-7-11-4/h5-6,11H,1,7-8H2,2-4H3/b6-5-,12-10+ |
| InChIKey | SVUCENMWEXAZCZ-UDMPHVCXSA-N |
| XLogP | 1.80 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|