C11H19N3 — CID 123475839
N-methyl-1-[[(2Z,5Z)-octa-2,5,7-trien-4-ylidene]amino]ethane-1,2-diamine (PubChem CID 123475839) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is N-methyl-1-[[(2Z,5Z)-octa-2,5,7-trien-4-ylidene]amino]ethane-1,2-diamine.
| Compound Name | N-methyl-1-[[(2Z,5Z)-octa-2,5,7-trien-4-ylidene]amino]ethane-1,2-diamine |
|---|---|
| PubChem CID | 123475839 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | N-methyl-1-[[(2Z,5Z)-octa-2,5,7-trien-4-ylidene]amino]ethane-1,2-diamine |
| SMILES | C=C/C=C\C(/C=C\C)=NC(CN)NC |
| InChI | InChI=1S/C11H19N3/c1-4-6-8-10(7-5-2)14-11(9-12)13-3/h4-8,11,13H,1,9,12H2,2-3H3/b7-5-,8-6-,14-10? |
| InChIKey | YAVJGHVNRPFNDL-LXQRQBIFSA-N |
| XLogP | 1.25 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|