C10H20N2 — CID 142057531
(3Z)-2-methyliminohexa-3,5-dien-1-amine;propane (PubChem CID 142057531) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is (3Z)-2-methyliminohexa-3,5-dien-1-amine;propane.
| Compound Name | (3Z)-2-methyliminohexa-3,5-dien-1-amine;propane |
|---|---|
| PubChem CID | 142057531 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | (3Z)-2-methyliminohexa-3,5-dien-1-amine;propane |
| SMILES | C=C/C=C\C(CN)=N\C.CCC |
| InChI | InChI=1S/C7H12N2.C3H8/c1-3-4-5-7(6-8)9-2;1-3-2/h3-5H,1,6,8H2,2H3;3H2,1-2H3/b5-4-,9-7-; |
| InChIKey | BBXVMTAIWBBYLN-VWOXCGMMSA-N |
| XLogP | 2.17 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|