C27H36N3O4P — CID 123210140
[4-[9-(8-methyl-5-tricyclo[5.2.1.03,9]decanyl)-9-azabicyclo[3.3.1]nonan-3-yl]-3-oxoquinoxalin-2-yl]phosphonic acid (PubChem CID 123210140) has the molecular formula C27H36N3O4P and a molecular weight of 497.58 g/mol. Its IUPAC name is [4-[9-(8-methyl-5-tricyclo[5.2.1.03,9]decanyl)-9-azabicyclo[3.3.1]nonan-3-yl]-3-oxoquinoxalin-2-yl]phosphonic acid.
| Compound Name | [4-[9-(8-methyl-5-tricyclo[5.2.1.03,9]decanyl)-9-azabicyclo[3.3.1]nonan-3-yl]-3-oxoquinoxalin-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 123210140 |
| Molecular Formula | C27H36N3O4P |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | [4-[9-(8-methyl-5-tricyclo[5.2.1.03,9]decanyl)-9-azabicyclo[3.3.1]nonan-3-yl]-3-oxoquinoxalin-2-yl]phosphonic acid |
| SMILES | CC1C2CC3CC(CC(N4C5CCCC4CC(n4c(=O)c(P(=O)(O)O)nc6ccccc64)C5)C2)C31 |
| InChI | InChI=1S/C27H36N3O4P/c1-15-16-9-17-10-18(25(15)17)12-21(11-16)29-19-5-4-6-20(29)14-22(13-19)30-24-8-3-2-7-23(24)28-26(27(30)31)35(32,33)34/h2-3,7-8,15-22,25H,4-6,9-14H2,1H3,(H2,32,33,34) |
| InChIKey | WNALBNWUNRULNG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|