C30H40N3O4P — CID 163710163
[3-oxo-4-[(3R,5S,7S)-9-[(3R,5S)-5-tricyclo[5.3.1.03,9]undecanyl]-9-azatricyclo[5.4.1.03,10]dodecan-5-yl]quinoxalin-2-yl]phosphonic acid (PubChem CID 163710163) has the molecular formula C30H40N3O4P and a molecular weight of 537.64 g/mol. Its IUPAC name is [3-oxo-4-[(3R,5S,7S)-9-[(3R,5S)-5-tricyclo[5.3.1.03,9]undecanyl]-9-azatricyclo[5.4.1.03,10]dodecan-5-yl]quinoxalin-2-yl]phosphonic acid.
| Compound Name | [3-oxo-4-[(3R,5S,7S)-9-[(3R,5S)-5-tricyclo[5.3.1.03,9]undecanyl]-9-azatricyclo[5.4.1.03,10]dodecan-5-yl]quinoxalin-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 163710163 |
| Molecular Formula | C30H40N3O4P |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.28 |
| IUPAC Name | [3-oxo-4-[(3R,5S,7S)-9-[(3R,5S)-5-tricyclo[5.3.1.03,9]undecanyl]-9-azatricyclo[5.4.1.03,10]dodecan-5-yl]quinoxalin-2-yl]phosphonic acid |
| SMILES | O=c1c(P(=O)(O)O)nc2ccccc2n1[C@H]1C[C@@H]2CC3CC([C@H](C3)C1)N([C@H]1CC3CC4CC(C3)[C@H](C4)C1)C2 |
| InChI | InChI=1S/C30H40N3O4P/c34-30-29(38(35,36)37)31-26-3-1-2-4-27(26)33(30)25-12-20-6-19-10-23(15-25)28(13-19)32(16-20)24-11-18-5-17-7-21(9-18)22(8-17)14-24/h1-4,17-25,28H,5-16H2,(H2,35,36,37)/t17?,18?,19?,20-,21?,22+,23+,24-,25-,28?/m0/s1 |
| InChIKey | KINJVFVLIAURSZ-IMOBZGGDSA-N |
| XLogP | 4.47 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|