C27H52S — CID 123211373
3-[10-ethyl-6,7,10,11-tetramethyl-4-(methylsulfanylmethyl)-5-propyltridecan-2-yl]cyclopropene (PubChem CID 123211373) has the molecular formula C27H52S and a molecular weight of 408.78 g/mol. Its IUPAC name is 3-[10-ethyl-6,7,10,11-tetramethyl-4-(methylsulfanylmethyl)-5-propyltridecan-2-yl]cyclopropene.
| Compound Name | 3-[10-ethyl-6,7,10,11-tetramethyl-4-(methylsulfanylmethyl)-5-propyltridecan-2-yl]cyclopropene |
|---|---|
| PubChem CID | 123211373 |
| Molecular Formula | C27H52S |
| Molecular Weight | 408.78 g/mol |
| Exact Mass | 408.38 |
| IUPAC Name | 3-[10-ethyl-6,7,10,11-tetramethyl-4-(methylsulfanylmethyl)-5-propyltridecan-2-yl]cyclopropene |
| SMILES | CCCC(C(CSC)CC(C)C1C=C1)C(C)C(C)CCC(C)(CC)C(C)CC |
| InChI | InChI=1S/C27H52S/c1-10-13-26(25(19-28-9)18-21(5)24-14-15-24)23(7)20(4)16-17-27(8,12-3)22(6)11-2/h14-15,20-26H,10-13,16-19H2,1-9H3 |
| InChIKey | VSSZFSAFSGEPAS-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.78 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|