About 3-ethyl-3,6,7,8-tetramethylundecane
3-ethyl-3,6,7,8-tetramethylundecane (PubChem CID 123359808) has the molecular formula C17H36
and a molecular weight of 240.47 g/mol. Its IUPAC name is 3-ethyl-3,6,7,8-tetramethylundecane.
Molecular Properties
| Compound Name | 3-ethyl-3,6,7,8-tetramethylundecane |
| PubChem CID | 123359808 |
| Molecular Formula | C17H36 |
| Molecular Weight | 240.47 g/mol |
| Exact Mass | 240.28 |
| IUPAC Name | 3-ethyl-3,6,7,8-tetramethylundecane |
| SMILES | CCCC(C)C(C)C(C)CCC(C)(CC)CC |
| InChI | InChI=1S/C17H36/c1-8-11-14(4)16(6)15(5)12-13-17(7,9-2)10-3/h14-16H,8-13H2,1-7H3 |
| InChIKey | NWJWJRLILFHHBW-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 240.47 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-ethyl-3,6,7,8-tetramethylundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-3,6,7,8-tetramethylundecane?
The IUPAC name of 3-ethyl-3,6,7,8-tetramethylundecane (CID 123359808) is 3-ethyl-3,6,7,8-tetramethylundecane.
What is the SMILES notation for 3-ethyl-3,6,7,8-tetramethylundecane?
The canonical SMILES for 3-ethyl-3,6,7,8-tetramethylundecane is CCCC(C)C(C)C(C)CCC(C)(CC)CC.
What is the InChIKey of 3-ethyl-3,6,7,8-tetramethylundecane?
The InChIKey is NWJWJRLILFHHBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36/c1-8-11-14(4)16(6)15(5)12-13-17(7,9-2)10-3/h14-16H,8-13H2,1-7H3.
What are the key properties of 3-ethyl-3,6,7,8-tetramethylundecane?
3-ethyl-3,6,7,8-tetramethylundecane has a molecular weight of 240.47 g/mol, XLogP of 6.30, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-3,6,7,8-tetramethylundecane is sourced from PubChem (CID 123359808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).