C12H28N6S2 — CID 123211872
1-(carbamothioylamino)-1,3-bis[3-(dimethylamino)propyl]thiourea (PubChem CID 123211872) has the molecular formula C12H28N6S2 and a molecular weight of 320.53 g/mol. Its IUPAC name is 1-(carbamothioylamino)-1,3-bis[3-(dimethylamino)propyl]thiourea.
| Compound Name | 1-(carbamothioylamino)-1,3-bis[3-(dimethylamino)propyl]thiourea |
|---|---|
| PubChem CID | 123211872 |
| Molecular Formula | C12H28N6S2 |
| Molecular Weight | 320.53 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 1-(carbamothioylamino)-1,3-bis[3-(dimethylamino)propyl]thiourea |
| SMILES | CN(C)CCCNC(=S)N(CCCN(C)C)NC(N)=S |
| InChI | InChI=1S/C12H28N6S2/c1-16(2)8-5-7-14-12(20)18(15-11(13)19)10-6-9-17(3)4/h5-10H2,1-4H3,(H,14,20)(H3,13,15,19) |
| InChIKey | SPDDLPPTVVRRQY-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 59.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.53 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|