C19H24FN5O — CID 123212162
2-[6-[3-(fluoromethyl)pyrrolidin-1-yl]pyrimidine-4-carboximidoyl]-4-propan-2-yloxyaniline (PubChem CID 123212162) has the molecular formula C19H24FN5O and a molecular weight of 357.43 g/mol. Its IUPAC name is 2-[6-[3-(fluoromethyl)pyrrolidin-1-yl]pyrimidine-4-carboximidoyl]-4-propan-2-yloxyaniline.
| Compound Name | 2-[6-[3-(fluoromethyl)pyrrolidin-1-yl]pyrimidine-4-carboximidoyl]-4-propan-2-yloxyaniline |
|---|---|
| PubChem CID | 123212162 |
| Molecular Formula | C19H24FN5O |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 2-[6-[3-(fluoromethyl)pyrrolidin-1-yl]pyrimidine-4-carboximidoyl]-4-propan-2-yloxyaniline |
| SMILES | [H]/N=C(\c1cc(N2CCC(CF)C2)ncn1)c1cc(OC(C)C)ccc1N |
| InChI | InChI=1S/C19H24FN5O/c1-12(2)26-14-3-4-16(21)15(7-14)19(22)17-8-18(24-11-23-17)25-6-5-13(9-20)10-25/h3-4,7-8,11-13,22H,5-6,9-10,21H2,1-2H3/b22-19- |
| InChIKey | MQHVPMYJOQGKFQ-QOCHGBHMSA-N |
| XLogP | 3.06 |
| TPSA | 88.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|