C9H13NO — CID 123212202
1-(4-methoxycyclohexa-1,3-dien-1-yl)ethanimine (PubChem CID 123212202) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 1-(4-methoxycyclohexa-1,3-dien-1-yl)ethanimine.
| Compound Name | 1-(4-methoxycyclohexa-1,3-dien-1-yl)ethanimine |
|---|---|
| PubChem CID | 123212202 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 1-(4-methoxycyclohexa-1,3-dien-1-yl)ethanimine |
| SMILES | [H]/N=C(\C)C1=CC=C(OC)CC1 |
| InChI | InChI=1S/C9H13NO/c1-7(10)8-3-5-9(11-2)6-4-8/h3,5,10H,4,6H2,1-2H3/b10-7+ |
| InChIKey | GXSUUKCFEMMRIN-JXMROGBWSA-N |
| XLogP | 2.28 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|