C16H18ClNO2 — CID 123215463
[2-(buta-1,3-dien-2-yloxymethyl)pyrrolidin-1-yl]-(4-chlorophenyl)methanone (PubChem CID 123215463) has the molecular formula C16H18ClNO2 and a molecular weight of 291.78 g/mol. Its IUPAC name is [2-(buta-1,3-dien-2-yloxymethyl)pyrrolidin-1-yl]-(4-chlorophenyl)methanone.
| Compound Name | [2-(buta-1,3-dien-2-yloxymethyl)pyrrolidin-1-yl]-(4-chlorophenyl)methanone |
|---|---|
| PubChem CID | 123215463 |
| Molecular Formula | C16H18ClNO2 |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | [2-(buta-1,3-dien-2-yloxymethyl)pyrrolidin-1-yl]-(4-chlorophenyl)methanone |
| SMILES | C=CC(=C)OCC1CCCN1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H18ClNO2/c1-3-12(2)20-11-15-5-4-10-18(15)16(19)13-6-8-14(17)9-7-13/h3,6-9,15H,1-2,4-5,10-11H2 |
| InChIKey | SIJLPVYKKVNBPA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|