C17H21NO2 — CID 123841527
[2-(buta-1,3-dien-2-yloxymethyl)pyrrolidin-1-yl]-(4-methylphenyl)methanone (PubChem CID 123841527) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is [2-(buta-1,3-dien-2-yloxymethyl)pyrrolidin-1-yl]-(4-methylphenyl)methanone.
| Compound Name | [2-(buta-1,3-dien-2-yloxymethyl)pyrrolidin-1-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 123841527 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | [2-(buta-1,3-dien-2-yloxymethyl)pyrrolidin-1-yl]-(4-methylphenyl)methanone |
| SMILES | C=CC(=C)OCC1CCCN1C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H21NO2/c1-4-14(3)20-12-16-6-5-11-18(16)17(19)15-9-7-13(2)8-10-15/h4,7-10,16H,1,3,5-6,11-12H2,2H3 |
| InChIKey | AFXCRGMZRBGELN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|