C16H19ClN2O3 — CID 71908080
(1-carbamoylpyrrolidin-2-yl)methyl 3-(4-chlorophenyl)-2-methylprop-2-enoate (PubChem CID 71908080) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is (1-carbamoylpyrrolidin-2-yl)methyl 3-(4-chlorophenyl)-2-methylprop-2-enoate.
| Compound Name | (1-carbamoylpyrrolidin-2-yl)methyl 3-(4-chlorophenyl)-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 71908080 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | (1-carbamoylpyrrolidin-2-yl)methyl 3-(4-chlorophenyl)-2-methylprop-2-enoate |
| SMILES | CC(=Cc1ccc(Cl)cc1)C(=O)OCC1CCCN1C(N)=O |
| InChI | InChI=1S/C16H19ClN2O3/c1-11(9-12-4-6-13(17)7-5-12)15(20)22-10-14-3-2-8-19(14)16(18)21/h4-7,9,14H,2-3,8,10H2,1H3,(H2,18,21) |
| InChIKey | STMNWKYVXCCLEP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|