C28H35FN6O3S — CID 123215828
2-(butylamino)-4-[2-(4-fluorophenyl)ethylamino]-N-(4-piperidin-1-ylsulfonylphenyl)pyrimidine-5-carboxamide (PubChem CID 123215828) has the molecular formula C28H35FN6O3S and a molecular weight of 554.69 g/mol. Its IUPAC name is 2-(butylamino)-4-[2-(4-fluorophenyl)ethylamino]-N-(4-piperidin-1-ylsulfonylphenyl)pyrimidine-5-carboxamide.
| Compound Name | 2-(butylamino)-4-[2-(4-fluorophenyl)ethylamino]-N-(4-piperidin-1-ylsulfonylphenyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 123215828 |
| Molecular Formula | C28H35FN6O3S |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | 2-(butylamino)-4-[2-(4-fluorophenyl)ethylamino]-N-(4-piperidin-1-ylsulfonylphenyl)pyrimidine-5-carboxamide |
| SMILES | CCCCNc1ncc(C(=O)Nc2ccc(S(=O)(=O)N3CCCCC3)cc2)c(NCCc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C28H35FN6O3S/c1-2-3-16-31-28-32-20-25(26(34-28)30-17-15-21-7-9-22(29)10-8-21)27(36)33-23-11-13-24(14-12-23)39(37,38)35-18-5-4-6-19-35/h7-14,20H,2-6,15-19H2,1H3,(H,33,36)(H2,30,31,32,34) |
| InChIKey | VMNZUEMQYFAQTB-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|