C25H36N6O6S — CID 72548338
2-(4-hydroxybutylamino)-4-[(4-hydroxycyclohexyl)amino]-N-(4-morpholin-4-ylsulfonylphenyl)pyrimidine-5-carboxamide (PubChem CID 72548338) has the molecular formula C25H36N6O6S and a molecular weight of 548.67 g/mol. Its IUPAC name is 2-(4-hydroxybutylamino)-4-[(4-hydroxycyclohexyl)amino]-N-(4-morpholin-4-ylsulfonylphenyl)pyrimidine-5-carboxamide.
| Compound Name | 2-(4-hydroxybutylamino)-4-[(4-hydroxycyclohexyl)amino]-N-(4-morpholin-4-ylsulfonylphenyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 72548338 |
| Molecular Formula | C25H36N6O6S |
| Molecular Weight | 548.67 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | 2-(4-hydroxybutylamino)-4-[(4-hydroxycyclohexyl)amino]-N-(4-morpholin-4-ylsulfonylphenyl)pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCOCC2)cc1)c1cnc(NCCCCO)nc1NC1CCC(O)CC1 |
| InChI | InChI=1S/C25H36N6O6S/c32-14-2-1-11-26-25-27-17-22(23(30-25)28-18-3-7-20(33)8-4-18)24(34)29-19-5-9-21(10-6-19)38(35,36)31-12-15-37-16-13-31/h5-6,9-10,17-18,20,32-33H,1-4,7-8,11-16H2,(H,29,34)(H2,26,27,28,30) |
| InChIKey | CFJWZDHLIXDHDU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 166.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.67 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|