C14H20N+ — CID 123216459
1,3-dimethyl-5,6,8,9-tetrahydro-4H-1-benzazonin-1-ium (PubChem CID 123216459) has the molecular formula C14H20N+ and a molecular weight of 202.32 g/mol. Its IUPAC name is 1,3-dimethyl-5,6,8,9-tetrahydro-4H-1-benzazonin-1-ium.
| Compound Name | 1,3-dimethyl-5,6,8,9-tetrahydro-4H-1-benzazonin-1-ium |
|---|---|
| PubChem CID | 123216459 |
| Molecular Formula | C14H20N+ |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 1,3-dimethyl-5,6,8,9-tetrahydro-4H-1-benzazonin-1-ium |
| SMILES | CC1=C/[N+](C)=C2/C=CCCC2=CCCC1 |
| InChI | InChI=1S/C14H20N/c1-12-7-3-4-8-13-9-5-6-10-14(13)15(2)11-12/h6,8,10-11H,3-5,7,9H2,1-2H3/q+1/b12-11?,13-8?,15-14- |
| InChIKey | VMXFKSJBQUKDQC-ZBIVGOTMSA-N |
| XLogP | 3.43 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|