C11H16N+ — CID 18684134
2,3,5-trimethyl-5,6-dihydro-1H-indolizin-4-ium (PubChem CID 18684134) has the molecular formula C11H16N+ and a molecular weight of 162.26 g/mol. Its IUPAC name is 2,3,5-trimethyl-5,6-dihydro-1H-indolizin-4-ium.
| Compound Name | 2,3,5-trimethyl-5,6-dihydro-1H-indolizin-4-ium |
|---|---|
| PubChem CID | 18684134 |
| Molecular Formula | C11H16N+ |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.13 |
| IUPAC Name | 2,3,5-trimethyl-5,6-dihydro-1H-indolizin-4-ium |
| SMILES | CC1=C(C)[N+]2=C(C=CCC2C)C1 |
| InChI | InChI=1S/C11H16N/c1-8-7-11-6-4-5-9(2)12(11)10(8)3/h4,6,9H,5,7H2,1-3H3/q+1 |
| InChIKey | PFOKLWSQAPFRFE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|