C9H12N+ — CID 122386243
1-methyl-3,5-dihydro-2H-indol-1-ium (PubChem CID 122386243) has the molecular formula C9H12N+ and a molecular weight of 134.20 g/mol. Its IUPAC name is 1-methyl-3,5-dihydro-2H-indol-1-ium.
| Compound Name | 1-methyl-3,5-dihydro-2H-indol-1-ium |
|---|---|
| PubChem CID | 122386243 |
| Molecular Formula | C9H12N+ |
| Molecular Weight | 134.20 g/mol |
| Exact Mass | 134.10 |
| IUPAC Name | 1-methyl-3,5-dihydro-2H-indol-1-ium |
| SMILES | C[N+]1=C2C=CCC=C2CC1 |
| InChI | InChI=1S/C9H12N/c1-10-7-6-8-4-2-3-5-9(8)10/h3-5H,2,6-7H2,1H3/q+1 |
| InChIKey | WWNQBJRKJUMOAK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.20 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|