C14H24N2 — CID 23463958
N,N-dipropyl-4,5,6,7-tetrahydro-2H-indol-5-amine (PubChem CID 23463958) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is N,N-dipropyl-4,5,6,7-tetrahydro-2H-indol-5-amine.
| Compound Name | N,N-dipropyl-4,5,6,7-tetrahydro-2H-indol-5-amine |
|---|---|
| PubChem CID | 23463958 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | N,N-dipropyl-4,5,6,7-tetrahydro-2H-indol-5-amine |
| SMILES | CCCN(CCC)C1CCC2=NCC=C2C1 |
| InChI | InChI=1S/C14H24N2/c1-3-9-16(10-4-2)13-5-6-14-12(11-13)7-8-15-14/h7,13H,3-6,8-11H2,1-2H3 |
| InChIKey | BKWWGJIVIRWENW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |