C13H16N+ — CID 91110202
1-methyl-4,6,8,9-tetrahydro-3H-pyrido[2,1-a]isoindol-5-ium (PubChem CID 91110202) has the molecular formula C13H16N+ and a molecular weight of 186.28 g/mol. Its IUPAC name is 1-methyl-4,6,8,9-tetrahydro-3H-pyrido[2,1-a]isoindol-5-ium.
| Compound Name | 1-methyl-4,6,8,9-tetrahydro-3H-pyrido[2,1-a]isoindol-5-ium |
|---|---|
| PubChem CID | 91110202 |
| Molecular Formula | C13H16N+ |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 1-methyl-4,6,8,9-tetrahydro-3H-pyrido[2,1-a]isoindol-5-ium |
| SMILES | CC1=CCC[N+]2=C1C1=CCCC=C1C2 |
| InChI | InChI=1S/C13H16N/c1-10-5-4-8-14-9-11-6-2-3-7-12(11)13(10)14/h5-7H,2-4,8-9H2,1H3/q+1 |
| InChIKey | AMKIXRCFWQMPMB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|