C17H28N- — CID 91520850
1-butyl-4-ethyl-2,2,6-trimethyl-5-propan-2-ylidenepyridin-1-ium (PubChem CID 91520850) has the molecular formula C17H28N- and a molecular weight of 246.42 g/mol. Its IUPAC name is 1-butyl-4-ethyl-2,2,6-trimethyl-5-propan-2-ylidenepyridin-1-ium.
| Compound Name | 1-butyl-4-ethyl-2,2,6-trimethyl-5-propan-2-ylidenepyridin-1-ium |
|---|---|
| PubChem CID | 91520850 |
| Molecular Formula | C17H28N- |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.22 |
| IUPAC Name | 1-butyl-4-ethyl-2,2,6-trimethyl-5-propan-2-ylidenepyridin-1-ium |
| SMILES | [CH2-]CCC[N+]1=C(C)C(=C(C)C)C(C[CH2-])=CC1(C)C |
| InChI | InChI=1S/C17H28N/c1-8-10-11-18-14(5)16(13(3)4)15(9-2)12-17(18,6)7/h12H,1-2,8-11H2,3-7H3/q-1 |
| InChIKey | OOPDANPKHCJHHD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|