C22H40N2 — CID 170408527
(4E,6E)-8-(C,N-dimethylcarbonimidoyl)-4,7,9-trimethyl-N,N-dipropyldeca-4,6,8-trien-1-amine (PubChem CID 170408527) has the molecular formula C22H40N2 and a molecular weight of 332.58 g/mol. Its IUPAC name is (4E,6E)-8-(C,N-dimethylcarbonimidoyl)-4,7,9-trimethyl-N,N-dipropyldeca-4,6,8-trien-1-amine.
| Compound Name | (4E,6E)-8-(C,N-dimethylcarbonimidoyl)-4,7,9-trimethyl-N,N-dipropyldeca-4,6,8-trien-1-amine |
|---|---|
| PubChem CID | 170408527 |
| Molecular Formula | C22H40N2 |
| Molecular Weight | 332.58 g/mol |
| Exact Mass | 332.32 |
| IUPAC Name | (4E,6E)-8-(C,N-dimethylcarbonimidoyl)-4,7,9-trimethyl-N,N-dipropyldeca-4,6,8-trien-1-amine |
| SMILES | CCCN(CCC)CCC/C(C)=C/C=C(\C)C(=C(C)C)/C(C)=N/C |
| InChI | InChI=1S/C22H40N2/c1-9-15-24(16-10-2)17-11-12-19(5)13-14-20(6)22(18(3)4)21(7)23-8/h13-14H,9-12,15-17H2,1-8H3/b19-13+,20-14+,23-21+ |
| InChIKey | QVRAGYXJYGMDMR-VOGCKLQOSA-N |
| XLogP | 6.21 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.58 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|