C13H16N2 — CID 67309399
2,8-dimethyl-1,3,4,4a-tetrahydropyrido[4,3-b]indole (PubChem CID 67309399) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2,8-dimethyl-1,3,4,4a-tetrahydropyrido[4,3-b]indole.
| Compound Name | 2,8-dimethyl-1,3,4,4a-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 67309399 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 2,8-dimethyl-1,3,4,4a-tetrahydropyrido[4,3-b]indole |
| SMILES | Cc1ccc2c(c1)=C1CN(C)CCC1N=2 |
| InChI | InChI=1S/C13H16N2/c1-9-3-4-12-10(7-9)11-8-15(2)6-5-13(11)14-12/h3-4,7,13H,5-6,8H2,1-2H3 |
| InChIKey | SZARNROSAUSIND-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |