C7H10N+ — CID 91142984
2-methyl-2-azoniabicyclo[2.2.1]hepta-1,4(7)-diene (PubChem CID 91142984) has the molecular formula C7H10N+ and a molecular weight of 108.16 g/mol. Its IUPAC name is 2-methyl-2-azoniabicyclo[2.2.1]hepta-1,4(7)-diene.
| Compound Name | 2-methyl-2-azoniabicyclo[2.2.1]hepta-1,4(7)-diene |
|---|---|
| PubChem CID | 91142984 |
| Molecular Formula | C7H10N+ |
| Molecular Weight | 108.16 g/mol |
| Exact Mass | 108.08 |
| IUPAC Name | 2-methyl-2-azoniabicyclo[2.2.1]hepta-1,4(7)-diene |
| SMILES | C[N+]1=C2C=C(CC2)C1 |
| InChI | InChI=1S/C7H10N/c1-8-5-6-2-3-7(8)4-6/h4H,2-3,5H2,1H3/q+1 |
| InChIKey | QCRREVQGDQFAGC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 108.16 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|