C10H14N+ — CID 169322691
1,4,5-trimethyl-2,3-dihydrocyclopenta[b]pyrrol-1-ium (PubChem CID 169322691) has the molecular formula C10H14N+ and a molecular weight of 148.23 g/mol. Its IUPAC name is 1,4,5-trimethyl-2,3-dihydrocyclopenta[b]pyrrol-1-ium.
| Compound Name | 1,4,5-trimethyl-2,3-dihydrocyclopenta[b]pyrrol-1-ium |
|---|---|
| PubChem CID | 169322691 |
| Molecular Formula | C10H14N+ |
| Molecular Weight | 148.23 g/mol |
| Exact Mass | 148.11 |
| IUPAC Name | 1,4,5-trimethyl-2,3-dihydrocyclopenta[b]pyrrol-1-ium |
| SMILES | CC1=CC2=[N+](C)CCC2=C1C |
| InChI | InChI=1S/C10H14N/c1-7-6-10-9(8(7)2)4-5-11(10)3/h6H,4-5H2,1-3H3/q+1 |
| InChIKey | NZCLPCMTLPJRTG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|