C14H16NY21- — CID 158525456
5-(4-ethenyl-2-methylbenzene-5-id-1-yl)-1-methyl-3,4-dihydro-2H-pyrrol-1-ium;henicosakis(yttrium) (PubChem CID 158525456) has the molecular formula C14H16NY21- and a molecular weight of 2065.31 g/mol. Its IUPAC name is 5-(4-ethenyl-2-methylbenzene-5-id-1-yl)-1-methyl-3,4-dihydro-2H-pyrrol-1-ium;henicosakis(yttrium).
| Compound Name | 5-(4-ethenyl-2-methylbenzene-5-id-1-yl)-1-methyl-3,4-dihydro-2H-pyrrol-1-ium;henicosakis(yttrium) |
|---|---|
| PubChem CID | 158525456 |
| Molecular Formula | C14H16NY21- |
| Molecular Weight | 2065.31 g/mol |
| Exact Mass | 2065.15 |
| IUPAC Name | 5-(4-ethenyl-2-methylbenzene-5-id-1-yl)-1-methyl-3,4-dihydro-2H-pyrrol-1-ium;henicosakis(yttrium) |
| SMILES | [H]/[C-]=C/c1[c-]cc(C2=[N+](C)CCC2)c(C)c1.[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y] |
| InChI | InChI=1S/C14H16N.21Y/c1-4-12-7-8-13(11(2)10-12)14-6-5-9-15(14)3;;;;;;;;;;;;;;;;;;;;;/h1,4,8,10H,5-6,9H2,2-3H3;;;;;;;;;;;;;;;;;;;;;/q-1;;;;;;;;;;;;;;;;;;;;; |
| InChIKey | NBGOHUJYWVPVNU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 2065.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|