C14H28N4O3 — CID 123219122
N-(3-aminooxypropyl)-3-[[2-[(2S)-2-(113C)methyl(115N)azinan-1-yl]acetyl]amino](313C)propanamide (PubChem CID 123219122) has the molecular formula C14H28N4O3 and a molecular weight of 304.37 g/mol. Its IUPAC name is N-(3-aminooxypropyl)-3-[[2-[(2S)-2-(113C)methyl(115N)azinan-1-yl]acetyl]amino](313C)propanamide.
| Compound Name | N-(3-aminooxypropyl)-3-[[2-[(2S)-2-(113C)methyl(115N)azinan-1-yl]acetyl]amino](313C)propanamide |
|---|---|
| PubChem CID | 123219122 |
| Molecular Formula | C14H28N4O3 |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | N-(3-aminooxypropyl)-3-[[2-[(2S)-2-(113C)methyl(115N)azinan-1-yl]acetyl]amino](313C)propanamide |
| SMILES | [13CH3][C@H]1CCCC[15N]1C[13C](=O)N[13CH2]CC(=O)NCCCON |
| InChI | InChI=1S/C14H28N4O3/c1-12-5-2-3-9-18(12)11-14(20)17-8-6-13(19)16-7-4-10-21-15/h12H,2-11,15H2,1H3,(H,16,19)(H,17,20)/t12-/m0/s1/i1+1,8+1,14+1,18+1 |
| InChIKey | KRZDNTFQWRZSPV-MTPOGHMPSA-N |
| XLogP | -0.24 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|