C8H12O2 — CID 123219588
2-(3-methylbuta-1,3-dien-2-yloxy)prop-2-en-1-ol (PubChem CID 123219588) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is 2-(3-methylbuta-1,3-dien-2-yloxy)prop-2-en-1-ol.
| Compound Name | 2-(3-methylbuta-1,3-dien-2-yloxy)prop-2-en-1-ol |
|---|---|
| PubChem CID | 123219588 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 2-(3-methylbuta-1,3-dien-2-yloxy)prop-2-en-1-ol |
| SMILES | C=C(CO)OC(=C)C(=C)C |
| InChI | InChI=1S/C8H12O2/c1-6(2)8(4)10-7(3)5-9/h9H,1,3-5H2,2H3 |
| InChIKey | ZGPUTOYRIPXIEZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|