C8H8N5+ — CID 123220755
2-(7H-purin-1-ium-8-yl)propanenitrile (PubChem CID 123220755) has the molecular formula C8H8N5+ and a molecular weight of 174.19 g/mol. Its IUPAC name is 2-(7H-purin-1-ium-8-yl)propanenitrile.
| Compound Name | 2-(7H-purin-1-ium-8-yl)propanenitrile |
|---|---|
| PubChem CID | 123220755 |
| Molecular Formula | C8H8N5+ |
| Molecular Weight | 174.19 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 2-(7H-purin-1-ium-8-yl)propanenitrile |
| SMILES | CC(C#N)c1nc2nc[nH+]cc2[nH]1 |
| InChI | InChI=1S/C8H7N5/c1-5(2-9)7-12-6-3-10-4-11-8(6)13-7/h3-5H,1H3,(H,10,11,12,13)/p+1 |
| InChIKey | YBKJWNZDZLYMAQ-UHFFFAOYSA-O |
| XLogP | 0.40 |
| TPSA | 79.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.19 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |