C7H6N7O+ — CID 136593743
4-(7H-purin-1-ium-8-yl)-1,2,5-oxadiazol-3-amine (PubChem CID 136593743) has the molecular formula C7H6N7O+ and a molecular weight of 204.17 g/mol. Its IUPAC name is 4-(7H-purin-1-ium-8-yl)-1,2,5-oxadiazol-3-amine.
| Compound Name | 4-(7H-purin-1-ium-8-yl)-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 136593743 |
| Molecular Formula | C7H6N7O+ |
| Molecular Weight | 204.17 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 4-(7H-purin-1-ium-8-yl)-1,2,5-oxadiazol-3-amine |
| SMILES | Nc1nonc1-c1nc2nc[nH+]cc2[nH]1 |
| InChI | InChI=1S/C7H5N7O/c8-5-4(13-15-14-5)7-11-3-1-9-2-10-6(3)12-7/h1-2H,(H2,8,14)(H,9,10,11,12)/p+1 |
| InChIKey | UNWLZDGLQLDCGI-UHFFFAOYSA-O |
| XLogP | -0.60 |
| TPSA | 120.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.17 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |