About 4-(7H-purin-1-ium-8-yl)-1,2,5-oxadiazol-3-amine
4-(7H-purin-1-ium-8-yl)-1,2,5-oxadiazol-3-amine (PubChem CID 136593743) has the molecular formula C7H6N7O+
and a molecular weight of 204.17 g/mol. Its IUPAC name is 4-(7H-purin-1-ium-8-yl)-1,2,5-oxadiazol-3-amine.
Molecular Properties
| Compound Name | 4-(7H-purin-1-ium-8-yl)-1,2,5-oxadiazol-3-amine |
| PubChem CID | 136593743 |
| Molecular Formula | C7H6N7O+ |
| Molecular Weight | 204.17 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 4-(7H-purin-1-ium-8-yl)-1,2,5-oxadiazol-3-amine |
| SMILES | Nc1nonc1-c1nc2nc[nH+]cc2[nH]1 |
| InChI | InChI=1S/C7H5N7O/c8-5-4(13-15-14-5)7-11-3-1-9-2-10-6(3)12-7/h1-2H,(H2,8,14)(H,9,10,11,12)/p+1 |
| InChIKey | UNWLZDGLQLDCGI-UHFFFAOYSA-O |
| XLogP | -0.60 |
| TPSA | 120.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.17 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(7H-purin-1-ium-8-yl)-1,2,5-oxadiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(7H-purin-1-ium-8-yl)-1,2,5-oxadiazol-3-amine?
The IUPAC name of 4-(7H-purin-1-ium-8-yl)-1,2,5-oxadiazol-3-amine (CID 136593743) is 4-(7H-purin-1-ium-8-yl)-1,2,5-oxadiazol-3-amine.
What is the SMILES notation for 4-(7H-purin-1-ium-8-yl)-1,2,5-oxadiazol-3-amine?
The canonical SMILES for 4-(7H-purin-1-ium-8-yl)-1,2,5-oxadiazol-3-amine is Nc1nonc1-c1nc2nc[nH+]cc2[nH]1.
What is the InChIKey of 4-(7H-purin-1-ium-8-yl)-1,2,5-oxadiazol-3-amine?
The InChIKey is UNWLZDGLQLDCGI-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H5N7O/c8-5-4(13-15-14-5)7-11-3-1-9-2-10-6(3)12-7/h1-2H,(H2,8,14)(H,9,10,11,12)/p+1.
What are the key properties of 4-(7H-purin-1-ium-8-yl)-1,2,5-oxadiazol-3-amine?
4-(7H-purin-1-ium-8-yl)-1,2,5-oxadiazol-3-amine has a molecular weight of 204.17 g/mol, XLogP of -0.60, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(7H-purin-1-ium-8-yl)-1,2,5-oxadiazol-3-amine is sourced from PubChem (CID 136593743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).