C11H8N4O — CID 12536668
4-quinolin-2-yl-1,2,5-oxadiazol-3-amine (PubChem CID 12536668) has the molecular formula C11H8N4O and a molecular weight of 212.21 g/mol. Its IUPAC name is 4-quinolin-2-yl-1,2,5-oxadiazol-3-amine.
| Compound Name | 4-quinolin-2-yl-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 12536668 |
| Molecular Formula | C11H8N4O |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 4-quinolin-2-yl-1,2,5-oxadiazol-3-amine |
| SMILES | Nc1nonc1-c1ccc2ccccc2n1 |
| InChI | InChI=1S/C11H8N4O/c12-11-10(14-16-15-11)9-6-5-7-3-1-2-4-8(7)13-9/h1-6H,(H2,12,15) |
| InChIKey | UYABAZFOUVLUHD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |