About 7H-purin-1-ium cyanide
7H-purin-1-ium cyanide (PubChem CID 172712540) has the molecular formula C6H5N5
and a molecular weight of 147.14 g/mol. Its IUPAC name is 7H-purin-1-ium cyanide.
Molecular Properties
| Compound Name | 7H-purin-1-ium cyanide |
| PubChem CID | 172712540 |
| Molecular Formula | C6H5N5 |
| Molecular Weight | 147.14 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | 7H-purin-1-ium cyanide |
| SMILES | [C-]#N.c1nc2nc[nH+]cc2[nH]1 |
| InChI | InChI=1S/C5H4N4.CN/c1-4-5(8-2-6-1)9-3-7-4;1-2/h1-3H,(H,6,7,8,9);/q;-1/p+1 |
| InChIKey | FKZUKLSNUYZQJD-UHFFFAOYSA-O |
| XLogP | -0.13 |
| TPSA | 79.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.14 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 7H-purin-1-ium cyanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-purin-1-ium cyanide?
The IUPAC name of 7H-purin-1-ium cyanide (CID 172712540) is 7H-purin-1-ium cyanide.
What is the SMILES notation for 7H-purin-1-ium cyanide?
The canonical SMILES for 7H-purin-1-ium cyanide is [C-]#N.c1nc2nc[nH+]cc2[nH]1.
What is the InChIKey of 7H-purin-1-ium cyanide?
The InChIKey is FKZUKLSNUYZQJD-UHFFFAOYSA-O. The full InChI is InChI=1S/C5H4N4.CN/c1-4-5(8-2-6-1)9-3-7-4;1-2/h1-3H,(H,6,7,8,9);/q;-1/p+1.
What are the key properties of 7H-purin-1-ium cyanide?
7H-purin-1-ium cyanide has a molecular weight of 147.14 g/mol, XLogP of -0.13, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-purin-1-ium cyanide is sourced from PubChem (CID 172712540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).