C8H5N3 — CID 18007825
6-ethynyl-1H-imidazo[4,5-b]pyridine (PubChem CID 18007825) has the molecular formula C8H5N3 and a molecular weight of 143.15 g/mol. Its IUPAC name is 6-ethynyl-1H-imidazo[4,5-b]pyridine.
| Compound Name | 6-ethynyl-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 18007825 |
| Molecular Formula | C8H5N3 |
| Molecular Weight | 143.15 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | 6-ethynyl-1H-imidazo[4,5-b]pyridine |
| SMILES | C#Cc1cnc2nc[nH]c2c1 |
| InChI | InChI=1S/C8H5N3/c1-2-6-3-7-8(9-4-6)11-5-10-7/h1,3-5H,(H,9,10,11) |
| InChIKey | YPNIXMJEIIWTKT-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.15 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|