C8H10N4O2S — CID 168899012
N-ethyl-1H-imidazo[4,5-b]pyridine-6-sulfonamide (PubChem CID 168899012) has the molecular formula C8H10N4O2S and a molecular weight of 226.26 g/mol. Its IUPAC name is N-ethyl-1H-imidazo[4,5-b]pyridine-6-sulfonamide.
| Compound Name | N-ethyl-1H-imidazo[4,5-b]pyridine-6-sulfonamide |
|---|---|
| PubChem CID | 168899012 |
| Molecular Formula | C8H10N4O2S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | N-ethyl-1H-imidazo[4,5-b]pyridine-6-sulfonamide |
| SMILES | CCNS(=O)(=O)c1cnc2nc[nH]c2c1 |
| InChI | InChI=1S/C8H10N4O2S/c1-2-12-15(13,14)6-3-7-8(9-4-6)11-5-10-7/h3-5,12H,2H2,1H3,(H,9,10,11) |
| InChIKey | NWBJCCICILQMNF-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |