C4H3BN4 — CID 175774602
5H-imidazo[4,5-d][1,3,2]diazaborinine (PubChem CID 175774602) has the molecular formula C4H3BN4 and a molecular weight of 117.91 g/mol. Its IUPAC name is 5H-imidazo[4,5-d][1,3,2]diazaborinine.
| Compound Name | 5H-imidazo[4,5-d][1,3,2]diazaborinine |
|---|---|
| PubChem CID | 175774602 |
| Molecular Formula | C4H3BN4 |
| Molecular Weight | 117.91 g/mol |
| Exact Mass | 118.05 |
| IUPAC Name | 5H-imidazo[4,5-d][1,3,2]diazaborinine |
| SMILES | b1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/C4H3BN4/c1-3-4(7-2-6-3)9-5-8-1/h1-2H,(H,6,7,9) |
| InChIKey | KDZVMCQZMCMUCJ-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.91 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |