C10H7ClN4O — CID 96596110
4-(5-chloro-1H-indol-6-yl)-1,2,5-oxadiazol-3-amine (PubChem CID 96596110) has the molecular formula C10H7ClN4O and a molecular weight of 234.65 g/mol. Its IUPAC name is 4-(5-chloro-1H-indol-6-yl)-1,2,5-oxadiazol-3-amine.
| Compound Name | 4-(5-chloro-1H-indol-6-yl)-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 96596110 |
| Molecular Formula | C10H7ClN4O |
| Molecular Weight | 234.65 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 4-(5-chloro-1H-indol-6-yl)-1,2,5-oxadiazol-3-amine |
| SMILES | Nc1nonc1-c1cc2[nH]ccc2cc1Cl |
| InChI | InChI=1S/C10H7ClN4O/c11-7-3-5-1-2-13-8(5)4-6(7)9-10(12)15-16-14-9/h1-4,13H,(H2,12,15) |
| InChIKey | IKDWNGFVQNUEDU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.65 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |