C26H37NO5 — CID 123221679
4-amino-5-henicosa-3,6,9,12,15,18-hexaenoyloxy-5-oxopentanoic acid (PubChem CID 123221679) has the molecular formula C26H37NO5 and a molecular weight of 443.58 g/mol. Its IUPAC name is 4-amino-5-henicosa-3,6,9,12,15,18-hexaenoyloxy-5-oxopentanoic acid.
| Compound Name | 4-amino-5-henicosa-3,6,9,12,15,18-hexaenoyloxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 123221679 |
| Molecular Formula | C26H37NO5 |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | 4-amino-5-henicosa-3,6,9,12,15,18-hexaenoyloxy-5-oxopentanoic acid |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCC(=O)OC(=O)C(N)CCC(=O)O |
| InChI | InChI=1S/C26H37NO5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-25(30)32-26(31)23(27)21-22-24(28)29/h3-4,6-7,9-10,12-13,15-16,18-19,23H,2,5,8,11,14,17,20-22,27H2,1H3,(H,28,29) |
| InChIKey | JNTIHCOJUJXVHI-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|