C28H43NO3 — CID 140526962
(2-amino-4-methylpentanoyl) (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 140526962) has the molecular formula C28H43NO3 and a molecular weight of 441.66 g/mol. Its IUPAC name is (2-amino-4-methylpentanoyl) (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | (2-amino-4-methylpentanoyl) (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 140526962 |
| Molecular Formula | C28H43NO3 |
| Molecular Weight | 441.66 g/mol |
| Exact Mass | 441.32 |
| IUPAC Name | (2-amino-4-methylpentanoyl) (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OC(=O)C(N)CC(C)C |
| InChI | InChI=1S/C28H43NO3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-27(30)32-28(31)26(29)24-25(2)3/h5-6,8-9,11-12,14-15,17-18,20-21,25-26H,4,7,10,13,16,19,22-24,29H2,1-3H3/b6-5-,9-8-,12-11-,15-14-,18-17-,21-20- |
| InChIKey | SOWXNHVKPYGTEH-YNUSHXQLSA-N |
| XLogP | 6.91 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.66 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|