C17H30N2O5 — CID 123222257
4-(2,5-dihydroxypyrrol-1-yl)oxy-N-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]butanamide (PubChem CID 123222257) has the molecular formula C17H30N2O5 and a molecular weight of 342.44 g/mol. Its IUPAC name is 4-(2,5-dihydroxypyrrol-1-yl)oxy-N-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]butanamide.
| Compound Name | 4-(2,5-dihydroxypyrrol-1-yl)oxy-N-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]butanamide |
|---|---|
| PubChem CID | 123222257 |
| Molecular Formula | C17H30N2O5 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 4-(2,5-dihydroxypyrrol-1-yl)oxy-N-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]butanamide |
| SMILES | CC(C)(CCOC(C)(C)C)NC(=O)CCCOn1c(O)ccc1O |
| InChI | InChI=1S/C17H30N2O5/c1-16(2,3)23-12-10-17(4,5)18-13(20)7-6-11-24-19-14(21)8-9-15(19)22/h8-9,21-22H,6-7,10-12H2,1-5H3,(H,18,20) |
| InChIKey | TXYFEUSGKIUCOE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|