C31H36N7O4P — CID 123222875
1-[4-[2-[(1-amino-2-methyliminoethylidene)amino]pyrimidin-4-yl]oxynaphthalen-1-yl]-3-(5-tert-butyl-3-dimethylphosphoryl-2-methoxyphenyl)urea (PubChem CID 123222875) has the molecular formula C31H36N7O4P and a molecular weight of 601.65 g/mol. Its IUPAC name is 1-[4-[2-[(1-amino-2-methyliminoethylidene)amino]pyrimidin-4-yl]oxynaphthalen-1-yl]-3-(5-tert-butyl-3-dimethylphosphoryl-2-methoxyphenyl)urea.
| Compound Name | 1-[4-[2-[(1-amino-2-methyliminoethylidene)amino]pyrimidin-4-yl]oxynaphthalen-1-yl]-3-(5-tert-butyl-3-dimethylphosphoryl-2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 123222875 |
| Molecular Formula | C31H36N7O4P |
| Molecular Weight | 601.65 g/mol |
| Exact Mass | 601.26 |
| IUPAC Name | 1-[4-[2-[(1-amino-2-methyliminoethylidene)amino]pyrimidin-4-yl]oxynaphthalen-1-yl]-3-(5-tert-butyl-3-dimethylphosphoryl-2-methoxyphenyl)urea |
| SMILES | C/N=C/C(N)=Nc1nccc(Oc2ccc(NC(=O)Nc3cc(C(C)(C)C)cc(P(C)(C)=O)c3OC)c3ccccc23)n1 |
| InChI | InChI=1S/C31H36N7O4P/c1-31(2,3)19-16-23(28(41-5)25(17-19)43(6,7)40)36-30(39)35-22-12-13-24(21-11-9-8-10-20(21)22)42-27-14-15-34-29(38-27)37-26(32)18-33-4/h8-18H,1-7H3,(H2,35,36,39)(H2,32,34,37,38)/b33-18+ |
| InChIKey | HEIYSPBUILCMBY-DPNNOFEESA-N |
| XLogP | 6.31 |
| TPSA | 153.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.65 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|