C34H36N5O4P — CID 118181851
1-[4-(2-anilinopyrimidin-4-yl)oxynaphthalen-1-yl]-3-(5-tert-butyl-3-dimethylphosphoryl-2-methoxyphenyl)urea (PubChem CID 118181851) has the molecular formula C34H36N5O4P and a molecular weight of 609.67 g/mol. Its IUPAC name is 1-[4-(2-anilinopyrimidin-4-yl)oxynaphthalen-1-yl]-3-(5-tert-butyl-3-dimethylphosphoryl-2-methoxyphenyl)urea.
| Compound Name | 1-[4-(2-anilinopyrimidin-4-yl)oxynaphthalen-1-yl]-3-(5-tert-butyl-3-dimethylphosphoryl-2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 118181851 |
| Molecular Formula | C34H36N5O4P |
| Molecular Weight | 609.67 g/mol |
| Exact Mass | 609.25 |
| IUPAC Name | 1-[4-(2-anilinopyrimidin-4-yl)oxynaphthalen-1-yl]-3-(5-tert-butyl-3-dimethylphosphoryl-2-methoxyphenyl)urea |
| SMILES | COc1c(NC(=O)Nc2ccc(Oc3ccnc(Nc4ccccc4)n3)c3ccccc23)cc(C(C)(C)C)cc1P(C)(C)=O |
| InChI | InChI=1S/C34H36N5O4P/c1-34(2,3)22-20-27(31(42-4)29(21-22)44(5,6)41)38-33(40)37-26-16-17-28(25-15-11-10-14-24(25)26)43-30-18-19-35-32(39-30)36-23-12-8-7-9-13-23/h7-21H,1-6H3,(H,35,36,39)(H2,37,38,40) |
| InChIKey | DTGGTIWRYHDYPL-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.67 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|