C36H36N7O3P — CID 73332266
1-[4-(2-anilinopyrimidin-4-yl)oxynaphthalen-1-yl]-3-[3-tert-butyl-1-(3-dimethylphosphorylphenyl)pyrazol-5-yl]urea (PubChem CID 73332266) has the molecular formula C36H36N7O3P and a molecular weight of 645.70 g/mol. Its IUPAC name is 1-[4-(2-anilinopyrimidin-4-yl)oxynaphthalen-1-yl]-3-[3-tert-butyl-1-(3-dimethylphosphorylphenyl)pyrazol-5-yl]urea.
| Compound Name | 1-[4-(2-anilinopyrimidin-4-yl)oxynaphthalen-1-yl]-3-[3-tert-butyl-1-(3-dimethylphosphorylphenyl)pyrazol-5-yl]urea |
|---|---|
| PubChem CID | 73332266 |
| Molecular Formula | C36H36N7O3P |
| Molecular Weight | 645.70 g/mol |
| Exact Mass | 645.26 |
| IUPAC Name | 1-[4-(2-anilinopyrimidin-4-yl)oxynaphthalen-1-yl]-3-[3-tert-butyl-1-(3-dimethylphosphorylphenyl)pyrazol-5-yl]urea |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc(Oc3ccnc(Nc4ccccc4)n3)c3ccccc23)n(-c2cccc(P(C)(C)=O)c2)n1 |
| InChI | InChI=1S/C36H36N7O3P/c1-36(2,3)31-23-32(43(42-31)25-14-11-15-26(22-25)47(4,5)45)40-35(44)39-29-18-19-30(28-17-10-9-16-27(28)29)46-33-20-21-37-34(41-33)38-24-12-7-6-8-13-24/h6-23H,1-5H3,(H,37,38,41)(H2,39,40,44) |
| InChIKey | HDXHYUNJQZVAKU-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 123.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.70 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|