C36H39N5O6PS+ — CID 144866936
1-(5-tert-butyl-3-dimethylphosphoryl-2-methoxyphenyl)-3-[4-[2-[(2-hydroxy-2-oxo-1,3-dihydro-2-benzothiophen-5-yl)amino]pyrimidin-4-yl]oxynaphthalen-1-yl]urea (PubChem CID 144866936) has the molecular formula C36H39N5O6PS+ and a molecular weight of 700.78 g/mol. Its IUPAC name is 1-(5-tert-butyl-3-dimethylphosphoryl-2-methoxyphenyl)-3-[4-[2-[(2-hydroxy-2-oxo-1,3-dihydro-2-benzothiophen-5-yl)amino]pyrimidin-4-yl]oxynaphthalen-1-yl]urea.
| Compound Name | 1-(5-tert-butyl-3-dimethylphosphoryl-2-methoxyphenyl)-3-[4-[2-[(2-hydroxy-2-oxo-1,3-dihydro-2-benzothiophen-5-yl)amino]pyrimidin-4-yl]oxynaphthalen-1-yl]urea |
|---|---|
| PubChem CID | 144866936 |
| Molecular Formula | C36H39N5O6PS+ |
| Molecular Weight | 700.78 g/mol |
| Exact Mass | 700.24 |
| IUPAC Name | 1-(5-tert-butyl-3-dimethylphosphoryl-2-methoxyphenyl)-3-[4-[2-[(2-hydroxy-2-oxo-1,3-dihydro-2-benzothiophen-5-yl)amino]pyrimidin-4-yl]oxynaphthalen-1-yl]urea |
| SMILES | COc1c(NC(=O)Nc2ccc(Oc3ccnc(Nc4ccc5c(c4)C[S+](=O)(O)C5)n3)c3ccccc23)cc(C(C)(C)C)cc1P(C)(C)=O |
| InChI | InChI=1S/C36H38N5O6PS/c1-36(2,3)24-18-29(33(46-4)31(19-24)48(5,6)43)40-35(42)39-28-13-14-30(27-10-8-7-9-26(27)28)47-32-15-16-37-34(41-32)38-25-12-11-22-20-49(44,45)21-23(22)17-25/h7-19H,20-21H2,1-6H3,(H3-,37,38,39,40,41,42,44,45)/p+1 |
| InChIKey | CFVPSNFSDXDILD-UHFFFAOYSA-O |
| XLogP | 8.35 |
| TPSA | 151.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.78 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|