C29H46O3 — CID 123223928
(1-ethylcyclopentyl) 2-[[5-(2,2,5,5-tetramethylhexan-3-yl)-4a,5,6,8a-tetrahydronaphthalen-1-yl]oxy]acetate (PubChem CID 123223928) has the molecular formula C29H46O3 and a molecular weight of 442.68 g/mol. Its IUPAC name is (1-ethylcyclopentyl) 2-[[5-(2,2,5,5-tetramethylhexan-3-yl)-4a,5,6,8a-tetrahydronaphthalen-1-yl]oxy]acetate.
| Compound Name | (1-ethylcyclopentyl) 2-[[5-(2,2,5,5-tetramethylhexan-3-yl)-4a,5,6,8a-tetrahydronaphthalen-1-yl]oxy]acetate |
|---|---|
| PubChem CID | 123223928 |
| Molecular Formula | C29H46O3 |
| Molecular Weight | 442.68 g/mol |
| Exact Mass | 442.34 |
| IUPAC Name | (1-ethylcyclopentyl) 2-[[5-(2,2,5,5-tetramethylhexan-3-yl)-4a,5,6,8a-tetrahydronaphthalen-1-yl]oxy]acetate |
| SMILES | CCC1(OC(=O)COC2=CC=CC3C2C=CCC3C(CC(C)(C)C)C(C)(C)C)CCCC1 |
| InChI | InChI=1S/C29H46O3/c1-8-29(17-9-10-18-29)32-26(30)20-31-25-16-12-13-21-22(14-11-15-23(21)25)24(28(5,6)7)19-27(2,3)4/h11-13,15-16,21-24H,8-10,14,17-20H2,1-7H3 |
| InChIKey | UVLKTDRGQYOULM-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.68 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|