C31H50O3 — CID 123298153
2-cyclohexylpropan-2-yl 2-[[6-(2,2,5,5-tetramethylhexan-3-yl)-6,7,8,8a-tetrahydronaphthalen-2-yl]oxy]acetate (PubChem CID 123298153) has the molecular formula C31H50O3 and a molecular weight of 470.74 g/mol. Its IUPAC name is 2-cyclohexylpropan-2-yl 2-[[6-(2,2,5,5-tetramethylhexan-3-yl)-6,7,8,8a-tetrahydronaphthalen-2-yl]oxy]acetate.
| Compound Name | 2-cyclohexylpropan-2-yl 2-[[6-(2,2,5,5-tetramethylhexan-3-yl)-6,7,8,8a-tetrahydronaphthalen-2-yl]oxy]acetate |
|---|---|
| PubChem CID | 123298153 |
| Molecular Formula | C31H50O3 |
| Molecular Weight | 470.74 g/mol |
| Exact Mass | 470.38 |
| IUPAC Name | 2-cyclohexylpropan-2-yl 2-[[6-(2,2,5,5-tetramethylhexan-3-yl)-6,7,8,8a-tetrahydronaphthalen-2-yl]oxy]acetate |
| SMILES | CC(C)(C)CC(C1C=C2C=CC(OCC(=O)OC(C)(C)C3CCCCC3)=CC2CC1)C(C)(C)C |
| InChI | InChI=1S/C31H50O3/c1-29(2,3)20-27(30(4,5)6)24-15-14-23-19-26(17-16-22(23)18-24)33-21-28(32)34-31(7,8)25-12-10-9-11-13-25/h16-19,23-25,27H,9-15,20-21H2,1-8H3 |
| InChIKey | LWZSNURIDCMKQL-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.74 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |