C20H28O3 — CID 123224023
9-methoxy-5-methylpentacyclo[12.2.2.01,12.04,11.09,11]octadecane-2,16-dione (PubChem CID 123224023) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is 9-methoxy-5-methylpentacyclo[12.2.2.01,12.04,11.09,11]octadecane-2,16-dione.
| Compound Name | 9-methoxy-5-methylpentacyclo[12.2.2.01,12.04,11.09,11]octadecane-2,16-dione |
|---|---|
| PubChem CID | 123224023 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 9-methoxy-5-methylpentacyclo[12.2.2.01,12.04,11.09,11]octadecane-2,16-dione |
| SMILES | COC12CCCC(C)C3CC(=O)C45CCC(CC4=O)CC5C31C2 |
| InChI | InChI=1S/C20H28O3/c1-12-4-3-6-18(23-2)11-20(18)14(12)10-17(22)19-7-5-13(8-15(19)20)9-16(19)21/h12-15H,3-11H2,1-2H3 |
| InChIKey | SHBCTKFUYOCEPO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|