About [azido(phenyl)phosphoryl]benzene;methyl 5-iodocyclopenta-1,4-diene-1-carboxylate
[azido(phenyl)phosphoryl]benzene;methyl 5-iodocyclopenta-1,4-diene-1-carboxylate (PubChem CID 123224703) has the molecular formula C19H17IN3O3P
and a molecular weight of 493.24 g/mol. Its IUPAC name is [azido(phenyl)phosphoryl]benzene;methyl 5-iodocyclopenta-1,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | [azido(phenyl)phosphoryl]benzene;methyl 5-iodocyclopenta-1,4-diene-1-carboxylate |
| PubChem CID | 123224703 |
| Molecular Formula | C19H17IN3O3P |
| Molecular Weight | 493.24 g/mol |
| Exact Mass | 493.01 |
| IUPAC Name | [azido(phenyl)phosphoryl]benzene;methyl 5-iodocyclopenta-1,4-diene-1-carboxylate |
| SMILES | COC(=O)C1=CCC=C1I.[N-]=[N+]=NP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H10N3OP.C7H7IO2/c13-14-15-17(16,11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-10-7(9)5-3-2-4-6(5)8/h1-10H;3-4H,2H2,1H3 |
| InChIKey | GLOIUBCCTNXFDB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 493.24 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [azido(phenyl)phosphoryl]benzene;methyl 5-iodocyclopenta-1,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [azido(phenyl)phosphoryl]benzene;methyl 5-iodocyclopenta-1,4-diene-1-carboxylate?
The IUPAC name of [azido(phenyl)phosphoryl]benzene;methyl 5-iodocyclopenta-1,4-diene-1-carboxylate (CID 123224703) is [azido(phenyl)phosphoryl]benzene;methyl 5-iodocyclopenta-1,4-diene-1-carboxylate.
What is the SMILES notation for [azido(phenyl)phosphoryl]benzene;methyl 5-iodocyclopenta-1,4-diene-1-carboxylate?
The canonical SMILES for [azido(phenyl)phosphoryl]benzene;methyl 5-iodocyclopenta-1,4-diene-1-carboxylate is COC(=O)C1=CCC=C1I.[N-]=[N+]=NP(=O)(c1ccccc1)c1ccccc1.
What is the InChIKey of [azido(phenyl)phosphoryl]benzene;methyl 5-iodocyclopenta-1,4-diene-1-carboxylate?
The InChIKey is GLOIUBCCTNXFDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N3OP.C7H7IO2/c13-14-15-17(16,11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-10-7(9)5-3-2-4-6(5)8/h1-10H;3-4H,2H2,1H3.
What are the key properties of [azido(phenyl)phosphoryl]benzene;methyl 5-iodocyclopenta-1,4-diene-1-carboxylate?
[azido(phenyl)phosphoryl]benzene;methyl 5-iodocyclopenta-1,4-diene-1-carboxylate has a molecular weight of 493.24 g/mol, XLogP of 5.03, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [azido(phenyl)phosphoryl]benzene;methyl 5-iodocyclopenta-1,4-diene-1-carboxylate is sourced from PubChem (CID 123224703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).