About methyl 5-aminocyclopenta-1,4-diene-1-carboxylate;2-methylpropan-2-ol
methyl 5-aminocyclopenta-1,4-diene-1-carboxylate;2-methylpropan-2-ol (PubChem CID 123327615) has the molecular formula C11H19NO3
and a molecular weight of 213.28 g/mol. Its IUPAC name is methyl 5-aminocyclopenta-1,4-diene-1-carboxylate;2-methylpropan-2-ol.
Molecular Properties
| Compound Name | methyl 5-aminocyclopenta-1,4-diene-1-carboxylate;2-methylpropan-2-ol |
| PubChem CID | 123327615 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | methyl 5-aminocyclopenta-1,4-diene-1-carboxylate;2-methylpropan-2-ol |
| SMILES | CC(C)(C)O.COC(=O)C1=CCC=C1N |
| InChI | InChI=1S/C7H9NO2.C4H10O/c1-10-7(9)5-3-2-4-6(5)8;1-4(2,3)5/h3-4H,2,8H2,1H3;5H,1-3H3 |
| InChIKey | WYMUONSUQQGMMO-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 5-aminocyclopenta-1,4-diene-1-carboxylate;2-methylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-aminocyclopenta-1,4-diene-1-carboxylate;2-methylpropan-2-ol?
The IUPAC name of methyl 5-aminocyclopenta-1,4-diene-1-carboxylate;2-methylpropan-2-ol (CID 123327615) is methyl 5-aminocyclopenta-1,4-diene-1-carboxylate;2-methylpropan-2-ol.
What is the SMILES notation for methyl 5-aminocyclopenta-1,4-diene-1-carboxylate;2-methylpropan-2-ol?
The canonical SMILES for methyl 5-aminocyclopenta-1,4-diene-1-carboxylate;2-methylpropan-2-ol is CC(C)(C)O.COC(=O)C1=CCC=C1N.
What is the InChIKey of methyl 5-aminocyclopenta-1,4-diene-1-carboxylate;2-methylpropan-2-ol?
The InChIKey is WYMUONSUQQGMMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2.C4H10O/c1-10-7(9)5-3-2-4-6(5)8;1-4(2,3)5/h3-4H,2,8H2,1H3;5H,1-3H3.
What are the key properties of methyl 5-aminocyclopenta-1,4-diene-1-carboxylate;2-methylpropan-2-ol?
methyl 5-aminocyclopenta-1,4-diene-1-carboxylate;2-methylpropan-2-ol has a molecular weight of 213.28 g/mol, XLogP of 1.11, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-aminocyclopenta-1,4-diene-1-carboxylate;2-methylpropan-2-ol is sourced from PubChem (CID 123327615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).