About dimethyl 3-methylcyclohexa-2,6-diene-1,2-dicarboxylate
dimethyl 3-methylcyclohexa-2,6-diene-1,2-dicarboxylate (PubChem CID 12842808) has the molecular formula C11H14O4
and a molecular weight of 210.23 g/mol. Its IUPAC name is dimethyl 3-methylcyclohexa-2,6-diene-1,2-dicarboxylate.
Analyze dimethyl 3-methylcyclohexa-2,6-diene-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 3-methylcyclohexa-2,6-diene-1,2-dicarboxylate?
The IUPAC name of dimethyl 3-methylcyclohexa-2,6-diene-1,2-dicarboxylate (CID 12842808) is dimethyl 3-methylcyclohexa-2,6-diene-1,2-dicarboxylate.
What is the SMILES notation for dimethyl 3-methylcyclohexa-2,6-diene-1,2-dicarboxylate?
The canonical SMILES for dimethyl 3-methylcyclohexa-2,6-diene-1,2-dicarboxylate is COC(=O)C1=CCCC(C)=C1C(=O)OC.
What is the InChIKey of dimethyl 3-methylcyclohexa-2,6-diene-1,2-dicarboxylate?
The InChIKey is VDVZYFOCXHGXBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O4/c1-7-5-4-6-8(10(12)14-2)9(7)11(13)15-3/h6H,4-5H2,1-3H3.
What are the key properties of dimethyl 3-methylcyclohexa-2,6-diene-1,2-dicarboxylate?
dimethyl 3-methylcyclohexa-2,6-diene-1,2-dicarboxylate has a molecular weight of 210.23 g/mol, XLogP of 1.37, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 3-methylcyclohexa-2,6-diene-1,2-dicarboxylate is sourced from PubChem (CID 12842808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).